C17H26ClN3O2 — CID 175947511
tert-butyl 2-[2-amino-2-(4-chloro-2-pyridinyl)ethyl]piperidine-1-carboxylate (PubChem CID 175947511) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is tert-butyl 2-[2-amino-2-(4-chloro-2-pyridinyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-amino-2-(4-chloro-2-pyridinyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175947511 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl 2-[2-amino-2-(4-chloro-2-pyridinyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CC(N)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-17(2,3)23-16(22)21-9-5-4-6-13(21)11-14(19)15-10-12(18)7-8-20-15/h7-8,10,13-14H,4-6,9,11,19H2,1-3H3 |
| InChIKey | WOMJUQIFKMJSQP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |