C13H16BrNO — CID 175947885
N-[1-(4-bromophenyl)-2-deuterioethyl]-N-methylcyclopropanecarboxamide (PubChem CID 175947885) has the molecular formula C13H16BrNO and a molecular weight of 283.19 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-deuterioethyl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2-deuterioethyl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 175947885 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-deuterioethyl]-N-methylcyclopropanecarboxamide |
| SMILES | [2H]CC(c1ccc(Br)cc1)N(C)C(=O)C1CC1 |
| InChI | InChI=1S/C13H16BrNO/c1-9(10-5-7-12(14)8-6-10)15(2)13(16)11-3-4-11/h5-9,11H,3-4H2,1-2H3/i1D |
| InChIKey | BMNMKWSUHRHPFF-MICDWDOJSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |