C15H18BrF3NOS+ — CID 176658829
N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-N-methylthian-1-ium-4-carboxamide (PubChem CID 176658829) has the molecular formula C15H18BrF3NOS+ and a molecular weight of 397.28 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-N-methylthian-1-ium-4-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-N-methylthian-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 176658829 |
| Molecular Formula | C15H18BrF3NOS+ |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,2,2-trifluoroethyl]-N-methylthian-1-ium-4-carboxamide |
| SMILES | CN(C(=O)C1CC[SH+]CC1)C(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H17BrF3NOS/c1-20(14(21)11-6-8-22-9-7-11)13(15(17,18)19)10-2-4-12(16)5-3-10/h2-5,11,13H,6-9H2,1H3/p+1 |
| InChIKey | NUHBNQSDKUQOTK-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|