C15H17BrF3NOS — CID 175476429
N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylthiane-4-carboxamide (PubChem CID 175476429) has the molecular formula C15H17BrF3NOS and a molecular weight of 396.27 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylthiane-4-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylthiane-4-carboxamide |
|---|---|
| PubChem CID | 175476429 |
| Molecular Formula | C15H17BrF3NOS |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]-N-methylthiane-4-carboxamide |
| SMILES | CN(C(=O)C1CCSCC1)C(F)(c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C15H17BrF3NOS/c1-20(13(21)10-6-8-22-9-7-10)15(19,14(17)18)11-2-4-12(16)5-3-11/h2-5,10,14H,6-9H2,1H3 |
| InChIKey | IPSKLWOPEZZIAE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|