C15H19BrClF3N2O — CID 175476430
4-amino-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 175476430) has the molecular formula C15H19BrClF3N2O and a molecular weight of 415.68 g/mol. Its IUPAC name is 4-amino-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175476430 |
| Molecular Formula | C15H19BrClF3N2O |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 4-amino-N-[1-(4-bromophenyl)-1,2,2-trifluoroethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)NC(F)(c2ccc(Br)cc2)C(F)F)CC1 |
| InChI | InChI=1S/C15H18BrF3N2O.ClH/c16-11-5-3-10(4-6-11)15(19,14(17)18)21-13(22)9-1-7-12(20)8-2-9;/h3-6,9,12,14H,1-2,7-8,20H2,(H,21,22);1H |
| InChIKey | HECPTFSSKKGYIN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|