C17H20BrF3N2O3 — CID 175476390
[4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]carbamoyl]cyclohexyl]methylcarbamic acid (PubChem CID 175476390) has the molecular formula C17H20BrF3N2O3 and a molecular weight of 437.26 g/mol. Its IUPAC name is [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]carbamoyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]carbamoyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 175476390 |
| Molecular Formula | C17H20BrF3N2O3 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [4-[[1-(4-bromophenyl)-1,2,2-trifluoroethyl]carbamoyl]cyclohexyl]methylcarbamic acid |
| SMILES | O=C(O)NCC1CCC(C(=O)NC(F)(c2ccc(Br)cc2)C(F)F)CC1 |
| InChI | InChI=1S/C17H20BrF3N2O3/c18-13-7-5-12(6-8-13)17(21,15(19)20)23-14(24)11-3-1-10(2-4-11)9-22-16(25)26/h5-8,10-11,15,22H,1-4,9H2,(H,23,24)(H,25,26) |
| InChIKey | MEMGFKXVOWBBRN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|