C22H18F3NO3 — CID 175948864
[2-(dimethylamino)-2-oxoethyl] 7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate (PubChem CID 175948864) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 175948864 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylate |
| SMILES | CN(C)C(=O)COC(=O)c1ccc2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C22H18F3NO3/c1-26(2)20(27)13-29-21(28)17-6-4-15-3-5-16(11-18(15)12-17)14-7-9-19(10-8-14)22(23,24)25/h3-12H,13H2,1-2H3 |
| InChIKey | OVKYGHHREPTSFU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |