C18H18ClN3O3 — CID 175949318
benzyl N-[(6-chloro-2H-indazol-3-yl)methyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 175949318) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is benzyl N-[(6-chloro-2H-indazol-3-yl)methyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | benzyl N-[(6-chloro-2H-indazol-3-yl)methyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 175949318 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | benzyl N-[(6-chloro-2H-indazol-3-yl)methyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(OCc1ccccc1)N(CCO)Cc1[nH]nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H18ClN3O3/c19-14-6-7-15-16(10-14)20-21-17(15)11-22(8-9-23)18(24)25-12-13-4-2-1-3-5-13/h1-7,10,23H,8-9,11-12H2,(H,20,21) |
| InChIKey | UKWKQEQKQNUGDP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |