C4H7NO2 — CID 175949992
(3S,4R)-3-deuterio-4-hydroxypyrrolidin-2-one (PubChem CID 175949992) has the molecular formula C4H7NO2 and a molecular weight of 102.11 g/mol. Its IUPAC name is (3S,4R)-3-deuterio-4-hydroxypyrrolidin-2-one.
| Compound Name | (3S,4R)-3-deuterio-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 175949992 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | (3S,4R)-3-deuterio-4-hydroxypyrrolidin-2-one |
| SMILES | [2H][C@@H]1C(=O)NC[C@@H]1O |
| InChI | InChI=1S/C4H7NO2/c6-3-1-4(7)5-2-3/h3,6H,1-2H2,(H,5,7)/t3-/m1/s1/i1D/t1-,3+/m0 |
| InChIKey | IOGISYQVOGVIEU-VYCPELCBSA-N |
| XLogP | -1.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |