C17H19N5O3 — CID 175950625
ethyl (E)-3-[4-amino-2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrimidin-5-yl]prop-2-enoate (PubChem CID 175950625) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is ethyl (E)-3-[4-amino-2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-amino-2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 175950625 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl (E)-3-[4-amino-2-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(-c2c(OC)ncnc2C2CC2)nc1N |
| InChI | InChI=1S/C17H19N5O3/c1-3-25-12(23)7-6-11-8-19-16(22-15(11)18)13-14(10-4-5-10)20-9-21-17(13)24-2/h6-10H,3-5H2,1-2H3,(H2,18,19,22)/b7-6+ |
| InChIKey | PXNIZVDJOZCWJX-VOTSOKGWSA-N |
| XLogP | 1.98 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|