C17H19ClN4OSi — CID 175952460
2-[5-chloro-2-(4-trimethylsilyltriazol-1-yl)phenyl]-3-methyl-1H-pyridin-4-one (PubChem CID 175952460) has the molecular formula C17H19ClN4OSi and a molecular weight of 358.91 g/mol. Its IUPAC name is 2-[5-chloro-2-(4-trimethylsilyltriazol-1-yl)phenyl]-3-methyl-1H-pyridin-4-one.
| Compound Name | 2-[5-chloro-2-(4-trimethylsilyltriazol-1-yl)phenyl]-3-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 175952460 |
| Molecular Formula | C17H19ClN4OSi |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[5-chloro-2-(4-trimethylsilyltriazol-1-yl)phenyl]-3-methyl-1H-pyridin-4-one |
| SMILES | Cc1c(-c2cc(Cl)ccc2-n2cc([Si](C)(C)C)nn2)[nH]ccc1=O |
| InChI | InChI=1S/C17H19ClN4OSi/c1-11-15(23)7-8-19-17(11)13-9-12(18)5-6-14(13)22-10-16(20-21-22)24(2,3)4/h5-10H,1-4H3,(H,19,23) |
| InChIKey | HCUIDTRKVZQBFI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|