C15H12ClN5O3 — CID 137135843
ethyl 1-[4-chloro-2-(6-oxo-1H-pyrimidin-4-yl)phenyl]triazole-4-carboxylate (PubChem CID 137135843) has the molecular formula C15H12ClN5O3 and a molecular weight of 345.75 g/mol. Its IUPAC name is ethyl 1-[4-chloro-2-(6-oxo-1H-pyrimidin-4-yl)phenyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[4-chloro-2-(6-oxo-1H-pyrimidin-4-yl)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 137135843 |
| Molecular Formula | C15H12ClN5O3 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | ethyl 1-[4-chloro-2-(6-oxo-1H-pyrimidin-4-yl)phenyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(Cl)cc2-c2cc(=O)[nH]cn2)nn1 |
| InChI | InChI=1S/C15H12ClN5O3/c1-2-24-15(23)12-7-21(20-19-12)13-4-3-9(16)5-10(13)11-6-14(22)18-8-17-11/h3-8H,2H2,1H3,(H,17,18,22) |
| InChIKey | KNCRFMAOSNQURX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |