C32H37F2N7O — CID 175953526
N-[3-[3-(cyanomethyl)-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-4-[(cycloheptylamino)methyl]-7,7-difluoro-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide (PubChem CID 175953526) has the molecular formula C32H37F2N7O and a molecular weight of 573.69 g/mol. Its IUPAC name is N-[3-[3-(cyanomethyl)-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-4-[(cycloheptylamino)methyl]-7,7-difluoro-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide.
| Compound Name | N-[3-[3-(cyanomethyl)-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-4-[(cycloheptylamino)methyl]-7,7-difluoro-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175953526 |
| Molecular Formula | C32H37F2N7O |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[3-[3-(cyanomethyl)-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-4-[(cycloheptylamino)methyl]-7,7-difluoro-5,6-dihydrocyclopenta[b]pyridine-2-carboxamide |
| SMILES | Cn1cnnc1C1(c2cccc(NC(=O)c3cc(CNC4CCCCCC4)c4c(n3)C(F)(F)CC4)c2)CC(CC#N)C1 |
| InChI | InChI=1S/C32H37F2N7O/c1-41-20-37-40-30(41)31(17-21(18-31)12-14-35)23-7-6-10-25(16-23)38-29(42)27-15-22(19-36-24-8-4-2-3-5-9-24)26-11-13-32(33,34)28(26)39-27/h6-7,10,15-16,20-21,24,36H,2-5,8-9,11-13,17-19H2,1H3,(H,38,42) |
| InChIKey | UEJIJIFXHWVIFK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |