C21H23N5O2 — CID 175958440
1-[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175958440) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175958440 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2nccn3c(-c4ccc(OC)cc4)cnc23)CC1 |
| InChI | InChI=1S/C21H23N5O2/c1-3-19(27)25-11-8-16(9-12-25)24-20-21-23-14-18(26(21)13-10-22-20)15-4-6-17(28-2)7-5-15/h3-7,10,13-14,16H,1,8-9,11-12H2,2H3,(H,22,24) |
| InChIKey | CDRVVTXOXKBNLA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|