C27H30N6O4 — CID 175843584
5-[[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]amino]pentylcarbamic acid (PubChem CID 175843584) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is 5-[[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]amino]pentylcarbamic acid.
| Compound Name | 5-[[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]amino]pentylcarbamic acid |
|---|---|
| PubChem CID | 175843584 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 5-[[4-[[3-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzoyl]amino]pentylcarbamic acid |
| SMILES | COc1ccc(-c2cnc3c(Nc4ccc(C(=O)NCCCCCNC(=O)O)c(C)c4)nccn23)cc1 |
| InChI | InChI=1S/C27H30N6O4/c1-18-16-20(8-11-22(18)26(34)29-12-4-3-5-13-30-27(35)36)32-24-25-31-17-23(33(25)15-14-28-24)19-6-9-21(37-2)10-7-19/h6-11,14-17,30H,3-5,12-13H2,1-2H3,(H,28,32)(H,29,34)(H,35,36) |
| InChIKey | ZDXRBUIRPIVYAA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|