C27H30F2N6O2 — CID 166593418
N-[(5S)-5-aminohexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide (PubChem CID 166593418) has the molecular formula C27H30F2N6O2 and a molecular weight of 508.57 g/mol. Its IUPAC name is N-[(5S)-5-aminohexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide.
| Compound Name | N-[(5S)-5-aminohexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 166593418 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[(5S)-5-aminohexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide |
| SMILES | COc1ccc(-c2cnc3c(Nc4ccc(C(=O)NCCCC[C@H](C)N)c(C)c4)nccn23)c(F)c1F |
| InChI | InChI=1S/C27H30F2N6O2/c1-16-14-18(7-8-19(16)27(36)32-11-5-4-6-17(2)30)34-25-26-33-15-21(35(26)13-12-31-25)20-9-10-22(37-3)24(29)23(20)28/h7-10,12-15,17H,4-6,11,30H2,1-3H3,(H,31,34)(H,32,36)/t17-/m0/s1 |
| InChIKey | JVNOBKULMBWURK-KRWDZBQOSA-N |
| XLogP | 4.98 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|