C28H33ClF2N6O2 — CID 166579740
N-(7-aminoheptyl)-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide;hydrochloride (PubChem CID 166579740) has the molecular formula C28H33ClF2N6O2 and a molecular weight of 559.06 g/mol. Its IUPAC name is N-(7-aminoheptyl)-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide;hydrochloride.
| Compound Name | N-(7-aminoheptyl)-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 166579740 |
| Molecular Formula | C28H33ClF2N6O2 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N-(7-aminoheptyl)-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylbenzamide;hydrochloride |
| SMILES | COc1ccc(-c2cnc3c(Nc4ccc(C(=O)NCCCCCCCN)c(C)c4)nccn23)c(F)c1F.Cl |
| InChI | InChI=1S/C28H32F2N6O2.ClH/c1-18-16-19(8-9-20(18)28(37)33-13-7-5-3-4-6-12-31)35-26-27-34-17-22(36(27)15-14-32-26)21-10-11-23(38-2)25(30)24(21)29;/h8-11,14-17H,3-7,12-13,31H2,1-2H3,(H,32,35)(H,33,37);1H |
| InChIKey | GMKRUSOTLJZGRE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|