C29H32FN5O3 — CID 154961604
2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-methylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-(6-oxohexyl)benzamide (PubChem CID 154961604) has the molecular formula C29H32FN5O3 and a molecular weight of 517.61 g/mol. Its IUPAC name is 2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-methylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-(6-oxohexyl)benzamide.
| Compound Name | 2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-methylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-(6-oxohexyl)benzamide |
|---|---|
| PubChem CID | 154961604 |
| Molecular Formula | C29H32FN5O3 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-methylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-(6-oxohexyl)benzamide |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4C)cnc23)ccc1C(=O)NCCCCCC=O |
| InChI | InChI=1S/C29H32FN5O3/c1-4-20-17-21(9-10-23(20)29(37)32-13-7-5-6-8-16-36)34-27-28-33-18-24(35(28)15-14-31-27)22-11-12-25(38-3)26(30)19(22)2/h9-12,14-18H,4-8,13H2,1-3H3,(H,31,34)(H,32,37) |
| InChIKey | UNASYGOPBSLQRF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|