C28H32F2N6O3 — CID 175843668
N-[(5S)-5-amino-6-hydroxyhexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide (PubChem CID 175843668) has the molecular formula C28H32F2N6O3 and a molecular weight of 538.60 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-hydroxyhexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide.
| Compound Name | N-[(5S)-5-amino-6-hydroxyhexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide |
|---|---|
| PubChem CID | 175843668 |
| Molecular Formula | C28H32F2N6O3 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-[(5S)-5-amino-6-hydroxyhexyl]-4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylbenzamide |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4F)cnc23)ccc1C(=O)NCCCC[C@H](N)CO |
| InChI | InChI=1S/C28H32F2N6O3/c1-3-17-14-19(7-8-20(17)28(38)33-11-5-4-6-18(31)16-37)35-26-27-34-15-22(36(27)13-12-32-26)21-9-10-23(39-2)25(30)24(21)29/h7-10,12-15,18,37H,3-6,11,16,31H2,1-2H3,(H,32,35)(H,33,38)/t18-/m0/s1 |
| InChIKey | CCMFPZOHXSARPR-SFHVURJKSA-N |
| XLogP | 4.21 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|