C26H25F2N5O3 — CID 154951394
4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethyl-N-(4-oxobutyl)benzamide (PubChem CID 154951394) has the molecular formula C26H25F2N5O3 and a molecular weight of 493.51 g/mol. Its IUPAC name is 4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethyl-N-(4-oxobutyl)benzamide.
| Compound Name | 4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethyl-N-(4-oxobutyl)benzamide |
|---|---|
| PubChem CID | 154951394 |
| Molecular Formula | C26H25F2N5O3 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethyl-N-(4-oxobutyl)benzamide |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4F)cnc23)ccc1C(=O)NCCCC=O |
| InChI | InChI=1S/C26H25F2N5O3/c1-3-16-14-17(6-7-18(16)26(35)30-10-4-5-13-34)32-24-25-31-15-20(33(25)12-11-29-24)19-8-9-21(36-2)23(28)22(19)27/h6-9,11-15H,3-5,10H2,1-2H3,(H,29,32)(H,30,35) |
| InChIKey | ZYYAGXFVADFVQS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|