C28H34FN6O3P — CID 154953338
N-[2-(2-amino-2-methylpropoxy)ethyl]-2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-phosphanylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide (PubChem CID 154953338) has the molecular formula C28H34FN6O3P and a molecular weight of 552.59 g/mol. Its IUPAC name is N-[2-(2-amino-2-methylpropoxy)ethyl]-2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-phosphanylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide.
| Compound Name | N-[2-(2-amino-2-methylpropoxy)ethyl]-2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-phosphanylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
|---|---|
| PubChem CID | 154953338 |
| Molecular Formula | C28H34FN6O3P |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | N-[2-(2-amino-2-methylpropoxy)ethyl]-2-ethyl-4-[[3-(3-fluoro-4-methoxy-2-phosphanylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]benzamide |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4P)cnc23)ccc1C(=O)NCCOCC(C)(C)N |
| InChI | InChI=1S/C28H34FN6O3P/c1-5-17-14-18(6-7-19(17)27(36)32-11-13-38-16-28(2,3)30)34-25-26-33-15-21(35(26)12-10-31-25)20-8-9-22(37-4)23(29)24(20)39/h6-10,12,14-15H,5,11,13,16,30,39H2,1-4H3,(H,31,34)(H,32,36) |
| InChIKey | ICDWHYQRDUJLPY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|