C16H15N3O2 — CID 175960311
2-[(1S)-1-(3-methyl-1,2-oxazol-5-yl)ethyl]quinoline-4-carboxamide (PubChem CID 175960311) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(1S)-1-(3-methyl-1,2-oxazol-5-yl)ethyl]quinoline-4-carboxamide.
| Compound Name | 2-[(1S)-1-(3-methyl-1,2-oxazol-5-yl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 175960311 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[(1S)-1-(3-methyl-1,2-oxazol-5-yl)ethyl]quinoline-4-carboxamide |
| SMILES | Cc1cc([C@@H](C)c2cc(C(N)=O)c3ccccc3n2)on1 |
| InChI | InChI=1S/C16H15N3O2/c1-9-7-15(21-19-9)10(2)14-8-12(16(17)20)11-5-3-4-6-13(11)18-14/h3-8,10H,1-2H3,(H2,17,20)/t10-/m0/s1 |
| InChIKey | UVJWIZMNFRHRSB-JTQLQIEISA-N |
| XLogP | 2.78 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |