C16H17N3O2 — CID 131988907
3-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide (PubChem CID 131988907) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide.
| Compound Name | 3-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 131988907 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide |
| SMILES | Cc1c(C(N)=O)cc(C(C)c2ccccc2)nc1C(N)=O |
| InChI | InChI=1S/C16H17N3O2/c1-9(11-6-4-3-5-7-11)13-8-12(15(17)20)10(2)14(19-13)16(18)21/h3-9H,1-2H3,(H2,17,20)(H2,18,21) |
| InChIKey | PXDBDUGGAMVDPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |