About N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid
N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid (PubChem CID 175962918) has the molecular formula C16H18Cl2N2O2
and a molecular weight of 341.24 g/mol. Its IUPAC name is N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid |
| PubChem CID | 175962918 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid |
| SMILES | CC(C)N(C(=O)O)c1cccc(Cl)c1.ClNc1ccccc1 |
| InChI | InChI=1S/C10H12ClNO2.C6H6ClN/c1-7(2)12(10(13)14)9-5-3-4-8(11)6-9;7-8-6-4-2-1-3-5-6/h3-7H,1-2H3,(H,13,14);1-5,8H |
| InChIKey | PYXPBGFOTOGEJV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid?
The IUPAC name of N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid (CID 175962918) is N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid.
What is the SMILES notation for N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid?
The canonical SMILES for N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid is CC(C)N(C(=O)O)c1cccc(Cl)c1.ClNc1ccccc1.
What is the InChIKey of N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid?
The InChIKey is PYXPBGFOTOGEJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2.C6H6ClN/c1-7(2)12(10(13)14)9-5-3-4-8(11)6-9;7-8-6-4-2-1-3-5-6/h3-7H,1-2H3,(H,13,14);1-5,8H.
What are the key properties of N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid?
N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid has a molecular weight of 341.24 g/mol, XLogP of 5.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloroaniline;(3-chlorophenyl)-propan-2-ylcarbamic acid is sourced from PubChem (CID 175962918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).