C10H12ClNO4S — CID 7393703
(2R)-2-(3-chloro-N-methylsulfonylanilino)propanoic acid (PubChem CID 7393703) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is (2R)-2-(3-chloro-N-methylsulfonylanilino)propanoic acid.
| Compound Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 7393703 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)propanoic acid |
| SMILES | C[C@H](C(=O)O)N(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C10H12ClNO4S/c1-7(10(13)14)12(17(2,15)16)9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | CGIDUVLBGIJSEL-SSDOTTSWSA-N |
| XLogP | 1.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |