C12H17ClN2O3S — CID 40635196
(2R)-2-(3-chloro-N-methylsulfonylanilino)-N,N-dimethylpropanamide (PubChem CID 40635196) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is (2R)-2-(3-chloro-N-methylsulfonylanilino)-N,N-dimethylpropanamide.
| Compound Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 40635196 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2R)-2-(3-chloro-N-methylsulfonylanilino)-N,N-dimethylpropanamide |
| SMILES | C[C@H](C(=O)N(C)C)N(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C12H17ClN2O3S/c1-9(12(16)14(2)3)15(19(4,17)18)11-7-5-6-10(13)8-11/h5-9H,1-4H3/t9-/m1/s1 |
| InChIKey | GBGIGKWDWVTPNI-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |