C12H12F3N3O3 — CID 175963491
(2S)-3,3,3-trifluoro-1-N-[(6-nitro-1-benzofuran-2-yl)methyl]propane-1,2-diamine (PubChem CID 175963491) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-1-N-[(6-nitro-1-benzofuran-2-yl)methyl]propane-1,2-diamine.
| Compound Name | (2S)-3,3,3-trifluoro-1-N-[(6-nitro-1-benzofuran-2-yl)methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 175963491 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (2S)-3,3,3-trifluoro-1-N-[(6-nitro-1-benzofuran-2-yl)methyl]propane-1,2-diamine |
| SMILES | N[C@@H](CNCc1cc2ccc([N+](=O)[O-])cc2o1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O3/c13-12(14,15)11(16)6-17-5-9-3-7-1-2-8(18(19)20)4-10(7)21-9/h1-4,11,17H,5-6,16H2/t11-/m0/s1 |
| InChIKey | WDEXDAVCAWYVGP-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|