C26H28ClN5O3 — CID 175963882
N-[(1R)-1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-ethylpyrazole-3-carboxamide (PubChem CID 175963882) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is N-[(1R)-1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[(1R)-1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175963882 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[(1R)-1-[(1R,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)N[C@@H](C(=O)Nc1ccc(-c2c(Cl)cc[n+]([O-])c2C)cc1)C1C[C@@H]2C[C@@H]2C1 |
| InChI | InChI=1S/C26H28ClN5O3/c1-3-31-22(8-10-28-31)25(33)30-24(19-13-17-12-18(17)14-19)26(34)29-20-6-4-16(5-7-20)23-15(2)32(35)11-9-21(23)27/h4-11,17-19,24H,3,12-14H2,1-2H3,(H,29,34)(H,30,33)/t17-,18+,19?,24-/m1/s1 |
| InChIKey | CXCZRAKYDNASOD-WIWXZXLPSA-N |
| XLogP | 3.95 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|