C29H33N5O3 — CID 164514418
N-[(1S)-1-[(1S,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide (PubChem CID 164514418) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[(1S)-1-[(1S,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-[(1S)-1-[(1S,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 164514418 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[(1S)-1-[(1S,5S)-3-bicyclo[3.1.0]hexanyl]-2-[4-(2,4-dimethyl-1-oxidopyridin-1-ium-3-yl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1-c1ccc(NC(=O)[C@@H](NC(=O)c2ccc3n2CCNC3)C2C[C@@H]3C[C@H]3C2)cc1 |
| InChI | InChI=1S/C29H33N5O3/c1-17-9-11-34(37)18(2)26(17)19-3-5-23(6-4-19)31-29(36)27(22-14-20-13-21(20)15-22)32-28(35)25-8-7-24-16-30-10-12-33(24)25/h3-9,11,20-22,27,30H,10,12-16H2,1-2H3,(H,31,36)(H,32,35)/t20-,21-,27-/m0/s1 |
| InChIKey | QDMAYUFNRRQTCM-IZVMNLJQSA-N |
| XLogP | 3.29 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|