C28H31ClFN5O3 — CID 163275691
N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide (PubChem CID 163275691) has the molecular formula C28H31ClFN5O3 and a molecular weight of 540.04 g/mol. Its IUPAC name is N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 163275691 |
| Molecular Formula | C28H31ClFN5O3 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)-3-fluoroanilino]-1-cyclohexyl-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
| SMILES | Cc1c(-c2ccc(NC(=O)[C@@H](NC(=O)c3ccc4n3CCNC4)C3CCCCC3)cc2F)c(Cl)cc[n+]1[O-] |
| InChI | InChI=1S/C28H31ClFN5O3/c1-17-25(22(29)11-13-35(17)38)21-9-7-19(15-23(21)30)32-28(37)26(18-5-3-2-4-6-18)33-27(36)24-10-8-20-16-31-12-14-34(20)24/h7-11,13,15,18,26,31H,2-6,12,14,16H2,1H3,(H,32,37)(H,33,36)/t26-/m0/s1 |
| InChIKey | JNWDSIFXOSXBGZ-SANMLTNESA-N |
| XLogP | 4.31 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|