C30H37N5O2 — CID 170425451
N-[1-cycloheptyl-2-[4-(2,4-dimethyl-3-pyridinyl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide (PubChem CID 170425451) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[1-cycloheptyl-2-[4-(2,4-dimethyl-3-pyridinyl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | N-[1-cycloheptyl-2-[4-(2,4-dimethyl-3-pyridinyl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 170425451 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-[1-cycloheptyl-2-[4-(2,4-dimethyl-3-pyridinyl)anilino]-2-oxoethyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine-6-carboxamide |
| SMILES | Cc1ccnc(C)c1-c1ccc(NC(=O)C(NC(=O)c2ccc3n2CCNC3)C2CCCCCC2)cc1 |
| InChI | InChI=1S/C30H37N5O2/c1-20-15-16-32-21(2)27(20)22-9-11-24(12-10-22)33-30(37)28(23-7-5-3-4-6-8-23)34-29(36)26-14-13-25-19-31-17-18-35(25)26/h9-16,23,28,31H,3-8,17-19H2,1-2H3,(H,33,37)(H,34,36) |
| InChIKey | ZDJPBELFRLLFIC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |