C21H32N2O6P2 — CID 175964809
(3,5-diethyl-4-phosphono-3,5-dipyridin-2-ylheptan-4-yl)phosphonic acid (PubChem CID 175964809) has the molecular formula C21H32N2O6P2 and a molecular weight of 470.44 g/mol. Its IUPAC name is (3,5-diethyl-4-phosphono-3,5-dipyridin-2-ylheptan-4-yl)phosphonic acid.
| Compound Name | (3,5-diethyl-4-phosphono-3,5-dipyridin-2-ylheptan-4-yl)phosphonic acid |
|---|---|
| PubChem CID | 175964809 |
| Molecular Formula | C21H32N2O6P2 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (3,5-diethyl-4-phosphono-3,5-dipyridin-2-ylheptan-4-yl)phosphonic acid |
| SMILES | CCC(CC)(c1ccccn1)C(C(CC)(CC)c1ccccn1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C21H32N2O6P2/c1-5-19(6-2,17-13-9-11-15-22-17)21(30(24,25)26,31(27,28)29)20(7-3,8-4)18-14-10-12-16-23-18/h9-16H,5-8H2,1-4H3,(H2,24,25,26)(H2,27,28,29) |
| InChIKey | ZWCBVEXRLNFZEH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|