C31H41F3N2O8 — CID 175966514
tert-butyl (1R,5S)-1-[[4-[2-[(E)-4-ethoxy-1,1,1-trifluoro-4-oxobut-2-en-2-yl]oxyphenyl]cyclohexyl]oxymethyl]-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 175966514) has the molecular formula C31H41F3N2O8 and a molecular weight of 626.67 g/mol. Its IUPAC name is tert-butyl (1R,5S)-1-[[4-[2-[(E)-4-ethoxy-1,1,1-trifluoro-4-oxobut-2-en-2-yl]oxyphenyl]cyclohexyl]oxymethyl]-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | tert-butyl (1R,5S)-1-[[4-[2-[(E)-4-ethoxy-1,1,1-trifluoro-4-oxobut-2-en-2-yl]oxyphenyl]cyclohexyl]oxymethyl]-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 175966514 |
| Molecular Formula | C31H41F3N2O8 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | tert-butyl (1R,5S)-1-[[4-[2-[(E)-4-ethoxy-1,1,1-trifluoro-4-oxobut-2-en-2-yl]oxyphenyl]cyclohexyl]oxymethyl]-7-oxo-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CCOC(=O)/C=C(/Oc1ccccc1C1CCC(OC[C@@H]2N(C(=O)OC(C)(C)C)CC[C@@]23COCC(=O)N3)CC1)C(F)(F)F |
| InChI | InChI=1S/C31H41F3N2O8/c1-5-41-27(38)16-25(31(32,33)34)43-23-9-7-6-8-22(23)20-10-12-21(13-11-20)42-17-24-30(19-40-18-26(37)35-30)14-15-36(24)28(39)44-29(2,3)4/h6-9,16,20-21,24H,5,10-15,17-19H2,1-4H3,(H,35,37)/b25-16+/t20?,21?,24-,30+/m0/s1 |
| InChIKey | STNMKVFTFMSOFW-HRBRDADKSA-N |
| XLogP | 5.01 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|