C13H14F3N3O4 — CID 175969631
2-[[6-(trifluoromethoxy)-2-pyridinyl]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 175969631) has the molecular formula C13H14F3N3O4 and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-[[6-(trifluoromethoxy)-2-pyridinyl]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | 2-[[6-(trifluoromethoxy)-2-pyridinyl]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175969631 |
| Molecular Formula | C13H14F3N3O4 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[[6-(trifluoromethoxy)-2-pyridinyl]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)n1)C1CCCCN1C(=O)O |
| InChI | InChI=1S/C13H14F3N3O4/c14-13(15,16)23-10-6-3-5-9(17-10)18-11(20)8-4-1-2-7-19(8)12(21)22/h3,5-6,8H,1-2,4,7H2,(H,21,22)(H,17,18,20) |
| InChIKey | RQXBAFOXEGWOAA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |