C13H21F3N2O2 — CID 175970553
butyl 3-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 175970553) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is butyl 3-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | butyl 3-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 175970553 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | butyl 3-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCCOC(=O)N1C2CCC1CN(CC(F)(F)F)C2 |
| InChI | InChI=1S/C13H21F3N2O2/c1-2-3-6-20-12(19)18-10-4-5-11(18)8-17(7-10)9-13(14,15)16/h10-11H,2-9H2,1H3 |
| InChIKey | IXFWPAJJCSZSNC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|