C19H28N2O2 — CID 175973642
tert-butyl 2-(7-aminospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)acetate (PubChem CID 175973642) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is tert-butyl 2-(7-aminospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)acetate.
| Compound Name | tert-butyl 2-(7-aminospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)acetate |
|---|---|
| PubChem CID | 175973642 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl 2-(7-aminospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC2(CCc3c(N)cccc32)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-18(2,3)23-17(22)13-21-11-9-19(10-12-21)8-7-14-15(19)5-4-6-16(14)20/h4-6H,7-13,20H2,1-3H3 |
| InChIKey | UOXCPJKPXLFMOD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|