C10H18ClNO8 — CID 175973697
(2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S)-2-amino-4-chlorobutanoate (PubChem CID 175973697) has the molecular formula C10H18ClNO8 and a molecular weight of 315.71 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S)-2-amino-4-chlorobutanoate.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S)-2-amino-4-chlorobutanoate |
|---|---|
| PubChem CID | 175973697 |
| Molecular Formula | C10H18ClNO8 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (2S)-2-amino-4-chlorobutanoate |
| SMILES | CCOC(=O)[C@@H](N)CCCl.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H12ClNO2.C4H6O6/c1-2-10-6(9)5(8)3-4-7;5-1(3(7)8)2(6)4(9)10/h5H,2-4,8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t5-;1-,2-/m01/s1 |
| InChIKey | HUJGUJDIZBVDGP-IKQZNINXSA-N |
| XLogP | -1.62 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|