C10H7F2N — CID 175974049
1-(2-deuterio-4,6-difluorophenyl)pyrrole (PubChem CID 175974049) has the molecular formula C10H7F2N and a molecular weight of 180.18 g/mol. Its IUPAC name is 1-(2-deuterio-4,6-difluorophenyl)pyrrole.
| Compound Name | 1-(2-deuterio-4,6-difluorophenyl)pyrrole |
|---|---|
| PubChem CID | 175974049 |
| Molecular Formula | C10H7F2N |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-(2-deuterio-4,6-difluorophenyl)pyrrole |
| SMILES | [2H]c1cc(F)cc(F)c1-n1cccc1 |
| InChI | InChI=1S/C10H7F2N/c11-8-3-4-10(9(12)7-8)13-5-1-2-6-13/h1-7H/i4D |
| InChIKey | ZAZINVQEIDWJRC-QYKNYGDISA-N |
| XLogP | 2.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |