C23H50N2O6S2 — CID 175975835
2-aminoethanesulfonic acid;2-[[(Z)-nonadec-9-enyl]amino]ethanesulfonic acid (PubChem CID 175975835) has the molecular formula C23H50N2O6S2 and a molecular weight of 514.80 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;2-[[(Z)-nonadec-9-enyl]amino]ethanesulfonic acid.
| Compound Name | 2-aminoethanesulfonic acid;2-[[(Z)-nonadec-9-enyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 175975835 |
| Molecular Formula | C23H50N2O6S2 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-aminoethanesulfonic acid;2-[[(Z)-nonadec-9-enyl]amino]ethanesulfonic acid |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCNCCS(=O)(=O)O.NCCS(=O)(=O)O |
| InChI | InChI=1S/C21H43NO3S.C2H7NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-21-26(23,24)25;3-1-2-7(4,5)6/h10-11,22H,2-9,12-21H2,1H3,(H,23,24,25);1-3H2,(H,4,5,6)/b11-10-; |
| InChIKey | CJJUCFZEAPEVAK-GMFCBQQYSA-N |
| XLogP | 4.72 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|