C14H14N6O2 — CID 175980134
N-(3-nitrophenyl)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 175980134) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-(3-nitrophenyl)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-(3-nitrophenyl)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 175980134 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-(3-nitrophenyl)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CC(C)c1cnn2c(Nc3cccc([N+](=O)[O-])c3)ncnc12 |
| InChI | InChI=1S/C14H14N6O2/c1-9(2)12-7-17-19-13(12)15-8-16-14(19)18-10-4-3-5-11(6-10)20(21)22/h3-9H,1-2H3,(H,15,16,18) |
| InChIKey | LPBNABKVURCERJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|