C11H13N4O7+ — CID 175980960
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-carboxylic acid (PubChem CID 175980960) has the molecular formula C11H13N4O7+ and a molecular weight of 313.25 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-carboxylic acid.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-carboxylic acid |
|---|---|
| PubChem CID | 175980960 |
| Molecular Formula | C11H13N4O7+ |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-9-ium-7-carboxylic acid |
| SMILES | O=C(O)n1c[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C11H12N4O7/c16-1-4-6(17)7(18)10(22-4)15-3-14(11(20)21)5-8(15)12-2-13-9(5)19/h2-4,6-7,10,16-18H,1H2,(H-,12,13,19,20,21)/p+1/t4-,6-,7-,10-/m1/s1 |
| InChIKey | WHOJPTUJIWJJAY-KQYNXXCUSA-O |
| XLogP | -2.85 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|