C6H13N3O2 — CID 175982295
2-(hydroxymethyl)piperazine-1-carboxamide (PubChem CID 175982295) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-(hydroxymethyl)piperazine-1-carboxamide.
| Compound Name | 2-(hydroxymethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 175982295 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-(hydroxymethyl)piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCNCC1CO |
| InChI | InChI=1S/C6H13N3O2/c7-6(11)9-2-1-8-3-5(9)4-10/h5,8,10H,1-4H2,(H2,7,11) |
| InChIKey | UXBBEJLVAIAJOH-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |