C7H15N3O2 — CID 177056056
2-(hydroxymethyl)-N-methylpiperazine-1-carboxamide (PubChem CID 177056056) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-methylpiperazine-1-carboxamide.
| Compound Name | 2-(hydroxymethyl)-N-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 177056056 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-(hydroxymethyl)-N-methylpiperazine-1-carboxamide |
| SMILES | CNC(=O)N1CCNCC1CO |
| InChI | InChI=1S/C7H15N3O2/c1-8-7(12)10-3-2-9-4-6(10)5-11/h6,9,11H,2-5H2,1H3,(H,8,12) |
| InChIKey | HECASKGUXYRDMV-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |