C27H40N6O7 — CID 175984190
2-O-tert-butyl 7-O-prop-2-enyl (5R)-5-[(Z)-N'-[2-[3-(oxan-4-yl)pyrazol-1-yl]propanoyloxy]carbamimidoyl]-2,7-diazaspiro[3.4]octane-2,7-dicarboxylate (PubChem CID 175984190) has the molecular formula C27H40N6O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-prop-2-enyl (5R)-5-[(Z)-N'-[2-[3-(oxan-4-yl)pyrazol-1-yl]propanoyloxy]carbamimidoyl]-2,7-diazaspiro[3.4]octane-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-prop-2-enyl (5R)-5-[(Z)-N'-[2-[3-(oxan-4-yl)pyrazol-1-yl]propanoyloxy]carbamimidoyl]-2,7-diazaspiro[3.4]octane-2,7-dicarboxylate |
|---|---|
| PubChem CID | 175984190 |
| Molecular Formula | C27H40N6O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 2-O-tert-butyl 7-O-prop-2-enyl (5R)-5-[(Z)-N'-[2-[3-(oxan-4-yl)pyrazol-1-yl]propanoyloxy]carbamimidoyl]-2,7-diazaspiro[3.4]octane-2,7-dicarboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](/C(N)=N/OC(=O)C(C)n2ccc(C3CCOCC3)n2)C2(C1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C27H40N6O7/c1-6-11-38-24(35)31-14-20(27(15-31)16-32(17-27)25(36)39-26(3,4)5)22(28)30-40-23(34)18(2)33-10-7-21(29-33)19-8-12-37-13-9-19/h6-7,10,18-20H,1,8-9,11-17H2,2-5H3,(H2,28,30)/t18?,20-/m1/s1 |
| InChIKey | CNADHTLCHFHTLO-ROPPNANJSA-N |
| XLogP | 2.64 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|