C16H16N2O — CID 175984364
1-(3-methylphenyl)-3-pyridin-3-ylpyrrolidin-2-one (PubChem CID 175984364) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-pyridin-3-ylpyrrolidin-2-one.
| Compound Name | 1-(3-methylphenyl)-3-pyridin-3-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 175984364 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(3-methylphenyl)-3-pyridin-3-ylpyrrolidin-2-one |
| SMILES | Cc1cccc(N2CCC(c3cccnc3)C2=O)c1 |
| InChI | InChI=1S/C16H16N2O/c1-12-4-2-6-14(10-12)18-9-7-15(16(18)19)13-5-3-8-17-11-13/h2-6,8,10-11,15H,7,9H2,1H3 |
| InChIKey | ZJXLGWUNSGXICS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |