C13H17NO — CID 21249686
3-methyl-1-(3-methylphenyl)piperidin-2-one (PubChem CID 21249686) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-methyl-1-(3-methylphenyl)piperidin-2-one.
| Compound Name | 3-methyl-1-(3-methylphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 21249686 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-methyl-1-(3-methylphenyl)piperidin-2-one |
| SMILES | Cc1cccc(N2CCCC(C)C2=O)c1 |
| InChI | InChI=1S/C13H17NO/c1-10-5-3-7-12(9-10)14-8-4-6-11(2)13(14)15/h3,5,7,9,11H,4,6,8H2,1-2H3 |
| InChIKey | WHQVNMNGBIVKNT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |