C11H15N3O — CID 159461236
1-(6-amino-3-pyridinyl)-3-methylpiperidin-2-one (PubChem CID 159461236) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-3-methylpiperidin-2-one.
| Compound Name | 1-(6-amino-3-pyridinyl)-3-methylpiperidin-2-one |
|---|---|
| PubChem CID | 159461236 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-3-methylpiperidin-2-one |
| SMILES | CC1CCCN(c2ccc(N)nc2)C1=O |
| InChI | InChI=1S/C11H15N3O/c1-8-3-2-6-14(11(8)15)9-4-5-10(12)13-7-9/h4-5,7-8H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | JKNRGKJDHAKLQM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |