C11H15N3O2 — CID 118348357
4-(6-amino-3-pyridinyl)-2,2-dimethylmorpholin-3-one (PubChem CID 118348357) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-(6-amino-3-pyridinyl)-2,2-dimethylmorpholin-3-one.
| Compound Name | 4-(6-amino-3-pyridinyl)-2,2-dimethylmorpholin-3-one |
|---|---|
| PubChem CID | 118348357 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-(6-amino-3-pyridinyl)-2,2-dimethylmorpholin-3-one |
| SMILES | CC1(C)OCCN(c2ccc(N)nc2)C1=O |
| InChI | InChI=1S/C11H15N3O2/c1-11(2)10(15)14(5-6-16-11)8-3-4-9(12)13-7-8/h3-4,7H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | DHJJXOOZBQHBEJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |