C14H23N3O — CID 145146822
ethane;5-(1-oxa-8-azaspiro[3.5]nonan-8-yl)pyridin-2-amine (PubChem CID 145146822) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is ethane;5-(1-oxa-8-azaspiro[3.5]nonan-8-yl)pyridin-2-amine.
| Compound Name | ethane;5-(1-oxa-8-azaspiro[3.5]nonan-8-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 145146822 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | ethane;5-(1-oxa-8-azaspiro[3.5]nonan-8-yl)pyridin-2-amine |
| SMILES | CC.Nc1ccc(N2CCCC3(CCO3)C2)cn1 |
| InChI | InChI=1S/C12H17N3O.C2H6/c13-11-3-2-10(8-14-11)15-6-1-4-12(9-15)5-7-16-12;1-2/h2-3,8H,1,4-7,9H2,(H2,13,14);1-2H3 |
| InChIKey | HFNCRTIZPYECCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |