C12H22N2O3 — CID 175984726
butyl (5S)-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 175984726) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is butyl (5S)-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | butyl (5S)-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 175984726 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | butyl (5S)-9-oxa-2,6-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CCCCOC(=O)N1CC[C@@]2(COCCN2)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-2-3-7-17-11(15)14-6-4-12(9-14)10-16-8-5-13-12/h13H,2-10H2,1H3/t12-/m0/s1 |
| InChIKey | CSJANQZMPUCSDF-LBPRGKRZSA-N |
| XLogP | 0.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|